C21H27N3O2 — CID 108964542
N-ethyl-N',2,2-trimethyl-N-phenyl-N'-(2-pyridin-4-ylethyl)propanediamide (PubChem CID 108964542) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-ethyl-N',2,2-trimethyl-N-phenyl-N'-(2-pyridin-4-ylethyl)propanediamide.
| Compound Name | N-ethyl-N',2,2-trimethyl-N-phenyl-N'-(2-pyridin-4-ylethyl)propanediamide |
|---|---|
| PubChem CID | 108964542 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | N-ethyl-N',2,2-trimethyl-N-phenyl-N'-(2-pyridin-4-ylethyl)propanediamide |
| SMILES | CCN(C(=O)C(C)(C)C(=O)N(C)CCc1ccncc1)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O2/c1-5-24(18-9-7-6-8-10-18)20(26)21(2,3)19(25)23(4)16-13-17-11-14-22-15-12-17/h6-12,14-15H,5,13,16H2,1-4H3 |
| InChIKey | AOISHBBTTFLBDQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|