C19H22Cl2N2O2 — CID 108972648
1-N-[2-(cyclohexen-1-yl)ethyl]-1-N'-(2,5-dichlorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108972648) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is 1-N-[2-(cyclohexen-1-yl)ethyl]-1-N'-(2,5-dichlorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-1-N'-(2,5-dichlorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108972648 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-1-N'-(2,5-dichlorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1(C(=O)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c20-14-6-7-15(21)16(12-14)23-18(25)19(9-10-19)17(24)22-11-8-13-4-2-1-3-5-13/h4,6-7,12H,1-3,5,8-11H2,(H,22,24)(H,23,25) |
| InChIKey | RPKDKPGSAMZXJM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|