C19H23ClN2O4 — CID 108943007
methyl 4-chloro-3-[[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropanoyl]amino]benzoate (PubChem CID 108943007) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is methyl 4-chloro-3-[[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropanoyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108943007 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl 4-chloro-3-[[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CC(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C19H23ClN2O4/c1-26-19(25)14-7-8-15(20)16(11-14)22-18(24)12-17(23)21-10-9-13-5-3-2-4-6-13/h5,7-8,11H,2-4,6,9-10,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | USOQETSWIJKLSA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|