C16H23N3O2 — CID 108973473
1-N-[2-(dimethylamino)ethyl]-1-N'-(4-methylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108973473) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-1-N'-(4-methylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-1-N'-(4-methylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108973473 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-1-N'-(4-methylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2(C(=O)NCCN(C)C)CC2)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-12-4-6-13(7-5-12)18-15(21)16(8-9-16)14(20)17-10-11-19(2)3/h4-7H,8-11H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | IAKULRXPJGCRNX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|