C20H29N3O5 — CID 108974224
1-(4-ethylpiperazine-1-carbonyl)-N-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 108974224) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-(4-ethylpiperazine-1-carbonyl)-N-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-ethylpiperazine-1-carbonyl)-N-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108974224 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-(4-ethylpiperazine-1-carbonyl)-N-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | CCN1CCN(C(=O)C2(C(=O)Nc3cc(OC)c(OC)c(OC)c3)CC2)CC1 |
| InChI | InChI=1S/C20H29N3O5/c1-5-22-8-10-23(11-9-22)19(25)20(6-7-20)18(24)21-14-12-15(26-2)17(28-4)16(13-14)27-3/h12-13H,5-11H2,1-4H3,(H,21,24) |
| InChIKey | GXWGAEABCLYJPV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|