C35H62O6Si3 — CID 10897650
(1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,5-diynyl]cyclopent-2-ene-1-carbaldehyde (PubChem CID 10897650) has the molecular formula C35H62O6Si3 and a molecular weight of 663.13 g/mol. Its IUPAC name is (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,5-diynyl]cyclopent-2-ene-1-carbaldehyde.
| Compound Name | (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,5-diynyl]cyclopent-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 10897650 |
| Molecular Formula | C35H62O6Si3 |
| Molecular Weight | 663.13 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]hexa-1,5-diynyl]cyclopent-2-ene-1-carbaldehyde |
| SMILES | C#CC[C@](C#CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(C=O)O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C35H62O6Si3/c1-19-21-34(29-25-37-33(11,12)38-29,40-43(15,16)31(5,6)7)22-20-27-23-28(39-42(13,14)30(2,3)4)24-35(27,26-36)41-44(17,18)32(8,9)10/h1,23,26,28-29H,21,24-25H2,2-18H3/t28-,29-,34-,35+/m1/s1 |
| InChIKey | POUPWVPCQBPIAP-KAVKGSRRSA-N |
| XLogP | 8.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.13 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|