C35H62O6Si3 — CID 11239262
(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(3S,5R)-5-prop-2-ynyl-3,5-bis(triethylsilyloxy)cyclopenten-1-yl]-2-triethylsilyloxybut-3-ynal (PubChem CID 11239262) has the molecular formula C35H62O6Si3 and a molecular weight of 663.13 g/mol. Its IUPAC name is (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(3S,5R)-5-prop-2-ynyl-3,5-bis(triethylsilyloxy)cyclopenten-1-yl]-2-triethylsilyloxybut-3-ynal.
| Compound Name | (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(3S,5R)-5-prop-2-ynyl-3,5-bis(triethylsilyloxy)cyclopenten-1-yl]-2-triethylsilyloxybut-3-ynal |
|---|---|
| PubChem CID | 11239262 |
| Molecular Formula | C35H62O6Si3 |
| Molecular Weight | 663.13 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(3S,5R)-5-prop-2-ynyl-3,5-bis(triethylsilyloxy)cyclopenten-1-yl]-2-triethylsilyloxybut-3-ynal |
| SMILES | C#CC[C@@]1(O[Si](CC)(CC)CC)C[C@H](O[Si](CC)(CC)CC)C=C1C#C[C@](C=O)(O[Si](CC)(CC)CC)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C35H62O6Si3/c1-13-24-34(40-43(17-5,18-6)19-7)27-31(39-42(14-2,15-3)16-4)26-30(34)23-25-35(29-36,32-28-37-33(11,12)38-32)41-44(20-8,21-9)22-10/h1,26,29,31-32H,14-22,24,27-28H2,2-12H3/t31-,32+,34-,35-/m1/s1 |
| InChIKey | GRTYLRAUPPRMRH-WJKMXKTFSA-N |
| XLogP | 8.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.13 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|