C23H32O5Si — CID 11270015
(1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyloxiran-2-yl]ethynyl]cyclopent-2-ene-1-carbaldehyde (PubChem CID 11270015) has the molecular formula C23H32O5Si and a molecular weight of 416.59 g/mol. Its IUPAC name is (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyloxiran-2-yl]ethynyl]cyclopent-2-ene-1-carbaldehyde.
| Compound Name | (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyloxiran-2-yl]ethynyl]cyclopent-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 11270015 |
| Molecular Formula | C23H32O5Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (1S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[(2S,3R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethynyloxiran-2-yl]ethynyl]cyclopent-2-ene-1-carbaldehyde |
| SMILES | C#C[C@H]1O[C@]1(C#CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1C=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C23H32O5Si/c1-9-19-23(27-19,20-15-25-22(5,6)26-20)11-10-16-12-18(13-17(16)14-24)28-29(7,8)21(2,3)4/h1,12,14,17-20H,13,15H2,2-8H3/t17-,18-,19-,20-,23+/m1/s1 |
| InChIKey | SDJGSEKZJSLFOF-ZFVCPDAYSA-N |
| XLogP | 3.45 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|