C20H30N4O2 — CID 108979122
1-N',1-N'-diethyl-1-N-[4-(4-methylpiperazin-1-yl)phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 108979122) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-N',1-N'-diethyl-1-N-[4-(4-methylpiperazin-1-yl)phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N',1-N'-diethyl-1-N-[4-(4-methylpiperazin-1-yl)phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108979122 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 1-N',1-N'-diethyl-1-N-[4-(4-methylpiperazin-1-yl)phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1(C(=O)Nc2ccc(N3CCN(C)CC3)cc2)CC1 |
| InChI | InChI=1S/C20H30N4O2/c1-4-23(5-2)19(26)20(10-11-20)18(25)21-16-6-8-17(9-7-16)24-14-12-22(3)13-15-24/h6-9H,4-5,10-15H2,1-3H3,(H,21,25) |
| InChIKey | WJMHGMLQHUVIAQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|