C42H38N2O4P+ — CID 10897940
[3,5-bis[[[(2S)-2-hydroxy-2-phenylacetyl]amino]methyl]phenyl]-triphenylphosphanium (PubChem CID 10897940) has the molecular formula C42H38N2O4P+ and a molecular weight of 665.75 g/mol. Its IUPAC name is [3,5-bis[[[(2S)-2-hydroxy-2-phenylacetyl]amino]methyl]phenyl]-triphenylphosphanium.
| Compound Name | [3,5-bis[[[(2S)-2-hydroxy-2-phenylacetyl]amino]methyl]phenyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 10897940 |
| Molecular Formula | C42H38N2O4P+ |
| Molecular Weight | 665.75 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | [3,5-bis[[[(2S)-2-hydroxy-2-phenylacetyl]amino]methyl]phenyl]-triphenylphosphanium |
| SMILES | O=C(NCc1cc(CNC(=O)[C@@H](O)c2ccccc2)cc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C42H37N2O4P/c45-39(33-16-6-1-7-17-33)41(47)43-29-31-26-32(30-44-42(48)40(46)34-18-8-2-9-19-34)28-38(27-31)49(35-20-10-3-11-21-35,36-22-12-4-13-23-36)37-24-14-5-15-25-37/h1-28,39-40,45-46H,29-30H2,(H-,43,44,47,48)/p+1/t39-,40-/m0/s1 |
| InChIKey | JAOPJGDJKUDNPQ-ZAQUEYBZSA-O |
| XLogP | 5.01 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.75 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|