C19H18Cl2N2O2 — CID 108981521
1-N'-(3,5-dichlorophenyl)-1-N-(3,5-dimethylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108981521) has the molecular formula C19H18Cl2N2O2 and a molecular weight of 377.27 g/mol. Its IUPAC name is 1-N'-(3,5-dichlorophenyl)-1-N-(3,5-dimethylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3,5-dichlorophenyl)-1-N-(3,5-dimethylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108981521 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 1-N'-(3,5-dichlorophenyl)-1-N-(3,5-dimethylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C2(C(=O)Nc3cc(Cl)cc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-11-5-12(2)7-15(6-11)22-17(24)19(3-4-19)18(25)23-16-9-13(20)8-14(21)10-16/h5-10H,3-4H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | NZIVDDAHYUTMEW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|