C14H15Cl2NO3 — CID 19096840
ethyl 1-[(3,5-dichlorophenyl)carbamoyl]cyclobutane-1-carboxylate (PubChem CID 19096840) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is ethyl 1-[(3,5-dichlorophenyl)carbamoyl]cyclobutane-1-carboxylate.
| Compound Name | ethyl 1-[(3,5-dichlorophenyl)carbamoyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 19096840 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | ethyl 1-[(3,5-dichlorophenyl)carbamoyl]cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)Nc2cc(Cl)cc(Cl)c2)CCC1 |
| InChI | InChI=1S/C14H15Cl2NO3/c1-2-20-13(19)14(4-3-5-14)12(18)17-11-7-9(15)6-10(16)8-11/h6-8H,2-5H2,1H3,(H,17,18) |
| InChIKey | UUUXEDQEPAEVEZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|