C13H13Cl2NO5 — CID 163379830
ethyl 4-[(3,5-dichlorophenyl)carbamoyl]-1,3-dioxolane-4-carboxylate (PubChem CID 163379830) has the molecular formula C13H13Cl2NO5 and a molecular weight of 334.16 g/mol. Its IUPAC name is ethyl 4-[(3,5-dichlorophenyl)carbamoyl]-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl 4-[(3,5-dichlorophenyl)carbamoyl]-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 163379830 |
| Molecular Formula | C13H13Cl2NO5 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | ethyl 4-[(3,5-dichlorophenyl)carbamoyl]-1,3-dioxolane-4-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)Nc2cc(Cl)cc(Cl)c2)COCO1 |
| InChI | InChI=1S/C13H13Cl2NO5/c1-2-20-12(18)13(6-19-7-21-13)11(17)16-10-4-8(14)3-9(15)5-10/h3-5H,2,6-7H2,1H3,(H,16,17) |
| InChIKey | XJWABHFPQDZSHH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|