C24H27N3O2 — CID 108986160
1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethane-1,2-dione (PubChem CID 108986160) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 108986160 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethane-1,2-dione |
| SMILES | CC1Cc2ccccc2N1C(=O)C(=O)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C24H27N3O2/c1-19-18-21-11-5-6-12-22(21)27(19)24(29)23(28)26-16-14-25(15-17-26)13-7-10-20-8-3-2-4-9-20/h2-12,19H,13-18H2,1H3/b10-7+ |
| InChIKey | KTBHLFUELIFUQB-JXMROGBWSA-N |
| XLogP | 2.82 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|