C8H11NO2 — CID 10898895
ethyl (1S,4S)-2-azabicyclo[2.2.0]hex-5-ene-2-carboxylate (PubChem CID 10898895) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is ethyl (1S,4S)-2-azabicyclo[2.2.0]hex-5-ene-2-carboxylate.
| Compound Name | ethyl (1S,4S)-2-azabicyclo[2.2.0]hex-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10898895 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | ethyl (1S,4S)-2-azabicyclo[2.2.0]hex-5-ene-2-carboxylate |
| SMILES | CCOC(=O)N1C[C@@H]2C=C[C@@H]21 |
| InChI | InChI=1S/C8H11NO2/c1-2-11-8(10)9-5-6-3-4-7(6)9/h3-4,6-7H,2,5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | UDGWRCOHOIXKBM-BQBZGAKWSA-N |
| XLogP | 1.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|