C17H25N3O3 — CID 108990325
[4-(2-ethylpiperidine-1-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 108990325) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is [4-(2-ethylpiperidine-1-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(2-ethylpiperidine-1-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 108990325 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | [4-(2-ethylpiperidine-1-carbonyl)piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CCC1CCCCN1C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-2-14-6-3-4-8-20(14)17(22)19-11-9-18(10-12-19)16(21)15-7-5-13-23-15/h5,7,13-14H,2-4,6,8-12H2,1H3 |
| InChIKey | OVNBJLACFUZZFN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |