C15H21N3O2 — CID 108995956
4-[2-(2,4-dimethylanilino)acetyl]piperazine-1-carbaldehyde (PubChem CID 108995956) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[2-(2,4-dimethylanilino)acetyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(2,4-dimethylanilino)acetyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 108995956 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-[2-(2,4-dimethylanilino)acetyl]piperazine-1-carbaldehyde |
| SMILES | Cc1ccc(NCC(=O)N2CCN(C=O)CC2)c(C)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-12-3-4-14(13(2)9-12)16-10-15(20)18-7-5-17(11-19)6-8-18/h3-4,9,11,16H,5-8,10H2,1-2H3 |
| InChIKey | JJDUENRNVXMWHA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|