C9H14O3S — CID 10899693
(E)-1-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)but-2-en-1-ol (PubChem CID 10899693) has the molecular formula C9H14O3S and a molecular weight of 202.28 g/mol. Its IUPAC name is (E)-1-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)but-2-en-1-ol.
| Compound Name | (E)-1-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)but-2-en-1-ol |
|---|---|
| PubChem CID | 10899693 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | (E)-1-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)but-2-en-1-ol |
| SMILES | C/C=C/C(O)C1C(C)=CCS1(=O)=O |
| InChI | InChI=1S/C9H14O3S/c1-3-4-8(10)9-7(2)5-6-13(9,11)12/h3-5,8-10H,6H2,1-2H3/b4-3+ |
| InChIKey | OXQPRNPYFYPIJO-ONEGZZNKSA-N |
| XLogP | 0.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|