C11H14O3S — CID 163867959
(1S)-4-cyclopropylsulfonyl-2-ethenylcyclohexa-2,4-dien-1-ol (PubChem CID 163867959) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is (1S)-4-cyclopropylsulfonyl-2-ethenylcyclohexa-2,4-dien-1-ol.
| Compound Name | (1S)-4-cyclopropylsulfonyl-2-ethenylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 163867959 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (1S)-4-cyclopropylsulfonyl-2-ethenylcyclohexa-2,4-dien-1-ol |
| SMILES | C=CC1=CC(S(=O)(=O)C2CC2)=CC[C@@H]1O |
| InChI | InChI=1S/C11H14O3S/c1-2-8-7-10(5-6-11(8)12)15(13,14)9-3-4-9/h2,5,7,9,11-12H,1,3-4,6H2/t11-/m0/s1 |
| InChIKey | PIHHCTNBMRFNTR-NSHDSACASA-N |
| XLogP | 1.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |