C8H12O4S — CID 11252695
(1S,2S)-3-ethylsulfonylcyclohexa-3,5-diene-1,2-diol (PubChem CID 11252695) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is (1S,2S)-3-ethylsulfonylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2S)-3-ethylsulfonylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 11252695 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | (1S,2S)-3-ethylsulfonylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CCS(=O)(=O)C1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H12O4S/c1-2-13(11,12)7-5-3-4-6(9)8(7)10/h3-6,8-10H,2H2,1H3/t6-,8-/m0/s1 |
| InChIKey | HCPUWBRCPBEDFF-XPUUQOCRSA-N |
| XLogP | -0.40 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |