C9H13IO2S — CID 163528834
[(5S,6S)-5,6-dihydroxycyclohexa-1,3-dien-1-yl]-ethenyl-methyliodanuidylsulfanium (PubChem CID 163528834) has the molecular formula C9H13IO2S and a molecular weight of 312.17 g/mol. Its IUPAC name is [(5S,6S)-5,6-dihydroxycyclohexa-1,3-dien-1-yl]-ethenyl-methyliodanuidylsulfanium.
| Compound Name | [(5S,6S)-5,6-dihydroxycyclohexa-1,3-dien-1-yl]-ethenyl-methyliodanuidylsulfanium |
|---|---|
| PubChem CID | 163528834 |
| Molecular Formula | C9H13IO2S |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | [(5S,6S)-5,6-dihydroxycyclohexa-1,3-dien-1-yl]-ethenyl-methyliodanuidylsulfanium |
| SMILES | C=C[S+]([I-]C)C1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H13IO2S/c1-3-13(10-2)8-6-4-5-7(11)9(8)12/h3-7,9,11-12H,1H2,2H3/t7-,9-,13?/m0/s1 |
| InChIKey | RMJHZRFSBMSIFG-CQLVPKDDSA-N |
| XLogP | -2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|