C7H9IO2S — CID 11346633
(1S,2S)-4-iodo-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol (PubChem CID 11346633) has the molecular formula C7H9IO2S and a molecular weight of 284.12 g/mol. Its IUPAC name is (1S,2S)-4-iodo-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2S)-4-iodo-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 11346633 |
| Molecular Formula | C7H9IO2S |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | (1S,2S)-4-iodo-3-methylsulfanylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CSC1=C(I)C=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H9IO2S/c1-11-7-4(8)2-3-5(9)6(7)10/h2-3,5-6,9-10H,1H3/t5-,6-/m0/s1 |
| InChIKey | WHMUBBSDHSNJRC-WDSKDSINSA-N |
| XLogP | 1.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|