C7H10O2S — CID 71342465
3-methylsulfanylcyclohexa-3,5-diene-1,2-diol (PubChem CID 71342465) has the molecular formula C7H10O2S and a molecular weight of 158.22 g/mol. Its IUPAC name is 3-methylsulfanylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | 3-methylsulfanylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 71342465 |
| Molecular Formula | C7H10O2S |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 3-methylsulfanylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CSC1=CC=CC(O)C1O |
| InChI | InChI=1S/C7H10O2S/c1-10-6-4-2-3-5(8)7(6)9/h2-5,7-9H,1H3 |
| InChIKey | DBLGHEPWIKOYJW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |