C8H12O4S — CID 141314963
6-methoxy-1-methylsulfonylcyclohexa-2,4-dien-1-ol (PubChem CID 141314963) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is 6-methoxy-1-methylsulfonylcyclohexa-2,4-dien-1-ol.
| Compound Name | 6-methoxy-1-methylsulfonylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 141314963 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 6-methoxy-1-methylsulfonylcyclohexa-2,4-dien-1-ol |
| SMILES | COC1C=CC=CC1(O)S(C)(=O)=O |
| InChI | InChI=1S/C8H12O4S/c1-12-7-5-3-4-6-8(7,9)13(2,10)11/h3-7,9H,1-2H3 |
| InChIKey | MNUHQYBQJKZGCY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |