C9H18ClNO2 — CID 10899803
N-chloro-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxy]propanamide (PubChem CID 10899803) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is N-chloro-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxy]propanamide.
| Compound Name | N-chloro-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxy]propanamide |
|---|---|
| PubChem CID | 10899803 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-chloro-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxy]propanamide |
| SMILES | CC(C)(C)ON(Cl)C(=O)C(C)(C)C |
| InChI | InChI=1S/C9H18ClNO2/c1-8(2,3)7(12)11(10)13-9(4,5)6/h1-6H3 |
| InChIKey | XHZHISMUIPPXKZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|