C11H17ClN2O3 — CID 140509085
2-[(5-chloro-4-oxopent-1-yn-3-yl)-[(2-methylpropan-2-yl)oxy]amino]acetamide (PubChem CID 140509085) has the molecular formula C11H17ClN2O3 and a molecular weight of 260.72 g/mol. Its IUPAC name is 2-[(5-chloro-4-oxopent-1-yn-3-yl)-[(2-methylpropan-2-yl)oxy]amino]acetamide.
| Compound Name | 2-[(5-chloro-4-oxopent-1-yn-3-yl)-[(2-methylpropan-2-yl)oxy]amino]acetamide |
|---|---|
| PubChem CID | 140509085 |
| Molecular Formula | C11H17ClN2O3 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-[(5-chloro-4-oxopent-1-yn-3-yl)-[(2-methylpropan-2-yl)oxy]amino]acetamide |
| SMILES | C#CC(C(=O)CCl)N(CC(N)=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17ClN2O3/c1-5-8(9(15)6-12)14(7-10(13)16)17-11(2,3)4/h1,8H,6-7H2,2-4H3,(H2,13,16) |
| InChIKey | LAQYBZMYIJIEIA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|