About N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide
N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide (PubChem CID 63680724) has the molecular formula C8H15ClN2O2
and a molecular weight of 206.67 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide |
| PubChem CID | 63680724 |
| Molecular Formula | C8H15ClN2O2 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide |
| SMILES | CN(CC(N)=O)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C8H15ClN2O2/c1-8(2,5-9)7(13)11(3)4-6(10)12/h4-5H2,1-3H3,(H2,10,12) |
| InChIKey | OTCZIEFXKZCKPX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide?
The IUPAC name of N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide (CID 63680724) is N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide.
What is the SMILES notation for N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide?
The canonical SMILES for N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide is CN(CC(N)=O)C(=O)C(C)(C)CCl.
What is the InChIKey of N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide?
The InChIKey is OTCZIEFXKZCKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClN2O2/c1-8(2,5-9)7(13)11(3)4-6(10)12/h4-5H2,1-3H3,(H2,10,12).
What are the key properties of N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide?
N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide has a molecular weight of 206.67 g/mol, XLogP of 0.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide is sourced from PubChem (CID 63680724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).