C8H15ClN2O2 — CID 63680724
N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide (PubChem CID 63680724) has the molecular formula C8H15ClN2O2 and a molecular weight of 206.67 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 63680724 |
| Molecular Formula | C8H15ClN2O2 |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-chloro-N,2,2-trimethylpropanamide |
| SMILES | CN(CC(N)=O)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C8H15ClN2O2/c1-8(2,5-9)7(13)11(3)4-6(10)12/h4-5H2,1-3H3,(H2,10,12) |
| InChIKey | OTCZIEFXKZCKPX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|