C9H14ClF3N2O2 — CID 62728697
3-chloro-N,2-dimethyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide (PubChem CID 62728697) has the molecular formula C9H14ClF3N2O2 and a molecular weight of 274.67 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide.
| Compound Name | 3-chloro-N,2-dimethyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 62728697 |
| Molecular Formula | C9H14ClF3N2O2 |
| Molecular Weight | 274.67 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide |
| SMILES | CC(CCl)C(=O)N(C)CC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H14ClF3N2O2/c1-6(3-10)8(17)15(2)4-7(16)14-5-9(11,12)13/h6H,3-5H2,1-2H3,(H,14,16) |
| InChIKey | XCJKQFFAQMTDSJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.67 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|