C8H12ClF3N2O2 — CID 60949951
3-chloro-N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide (PubChem CID 60949951) has the molecular formula C8H12ClF3N2O2 and a molecular weight of 260.64 g/mol. Its IUPAC name is 3-chloro-N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide.
| Compound Name | 3-chloro-N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 60949951 |
| Molecular Formula | C8H12ClF3N2O2 |
| Molecular Weight | 260.64 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-chloro-N-methyl-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]propanamide |
| SMILES | CN(CC(=O)NCC(F)(F)F)C(=O)CCCl |
| InChI | InChI=1S/C8H12ClF3N2O2/c1-14(7(16)2-3-9)4-6(15)13-5-8(10,11)12/h2-5H2,1H3,(H,13,15) |
| InChIKey | PWUIQGOGSQHEGR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.64 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|