C7H13BrO2 — CID 10899837
(E)-4-bromo-1,1-dimethoxy-3-methylbut-2-ene (PubChem CID 10899837) has the molecular formula C7H13BrO2 and a molecular weight of 209.08 g/mol. Its IUPAC name is (E)-4-bromo-1,1-dimethoxy-3-methylbut-2-ene.
| Compound Name | (E)-4-bromo-1,1-dimethoxy-3-methylbut-2-ene |
|---|---|
| PubChem CID | 10899837 |
| Molecular Formula | C7H13BrO2 |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | (E)-4-bromo-1,1-dimethoxy-3-methylbut-2-ene |
| SMILES | COC(/C=C(\C)CBr)OC |
| InChI | InChI=1S/C7H13BrO2/c1-6(5-8)4-7(9-2)10-3/h4,7H,5H2,1-3H3/b6-4+ |
| InChIKey | NWXAXTQMYRQNKU-GQCTYLIASA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|