C7H11BrO2 — CID 10608390
(1Z,3E)-1-bromo-5,5-dimethoxypenta-1,3-diene (PubChem CID 10608390) has the molecular formula C7H11BrO2 and a molecular weight of 207.07 g/mol. Its IUPAC name is (1Z,3E)-1-bromo-5,5-dimethoxypenta-1,3-diene.
| Compound Name | (1Z,3E)-1-bromo-5,5-dimethoxypenta-1,3-diene |
|---|---|
| PubChem CID | 10608390 |
| Molecular Formula | C7H11BrO2 |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | (1Z,3E)-1-bromo-5,5-dimethoxypenta-1,3-diene |
| SMILES | COC(/C=C/C=C\Br)OC |
| InChI | InChI=1S/C7H11BrO2/c1-9-7(10-2)5-3-4-6-8/h3-7H,1-2H3/b5-3+,6-4- |
| InChIKey | ZONCBQXAGFWCLB-UZNMPDEFSA-N |
| XLogP | 2.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|