About 1,1-dimethoxyhexa-2,4-diene
1,1-dimethoxyhexa-2,4-diene (PubChem CID 57153125) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1,1-dimethoxyhexa-2,4-diene.
Molecular Properties
| Compound Name | 1,1-dimethoxyhexa-2,4-diene |
| PubChem CID | 57153125 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 1,1-dimethoxyhexa-2,4-diene |
| SMILES | CC=CC=CC(OC)OC |
| InChI | InChI=1S/C8H14O2/c1-4-5-6-7-8(9-2)10-3/h4-8H,1-3H3 |
| InChIKey | AHPWAHONMBZZRZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyhexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyhexa-2,4-diene?
The IUPAC name of 1,1-dimethoxyhexa-2,4-diene (CID 57153125) is 1,1-dimethoxyhexa-2,4-diene.
What is the SMILES notation for 1,1-dimethoxyhexa-2,4-diene?
The canonical SMILES for 1,1-dimethoxyhexa-2,4-diene is CC=CC=CC(OC)OC.
What is the InChIKey of 1,1-dimethoxyhexa-2,4-diene?
The InChIKey is AHPWAHONMBZZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-4-5-6-7-8(9-2)10-3/h4-8H,1-3H3.
What are the key properties of 1,1-dimethoxyhexa-2,4-diene?
1,1-dimethoxyhexa-2,4-diene has a molecular weight of 142.20 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyhexa-2,4-diene is sourced from PubChem (CID 57153125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).