C8H14O2 — CID 57153125
1,1-dimethoxyhexa-2,4-diene (PubChem CID 57153125) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 1,1-dimethoxyhexa-2,4-diene.
| Compound Name | 1,1-dimethoxyhexa-2,4-diene |
|---|---|
| PubChem CID | 57153125 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 1,1-dimethoxyhexa-2,4-diene |
| SMILES | CC=CC=CC(OC)OC |
| InChI | InChI=1S/C8H14O2/c1-4-5-6-7-8(9-2)10-3/h4-8H,1-3H3 |
| InChIKey | AHPWAHONMBZZRZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|