C11H17BrO2 — CID 11402739
(1E,3E,5Z)-1-bromo-7,7-diethoxyhepta-1,3,5-triene (PubChem CID 11402739) has the molecular formula C11H17BrO2 and a molecular weight of 261.16 g/mol. Its IUPAC name is (1E,3E,5Z)-1-bromo-7,7-diethoxyhepta-1,3,5-triene.
| Compound Name | (1E,3E,5Z)-1-bromo-7,7-diethoxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 11402739 |
| Molecular Formula | C11H17BrO2 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (1E,3E,5Z)-1-bromo-7,7-diethoxyhepta-1,3,5-triene |
| SMILES | CCOC(/C=C\C=C\C=C\Br)OCC |
| InChI | InChI=1S/C11H17BrO2/c1-3-13-11(14-4-2)9-7-5-6-8-10-12/h5-11H,3-4H2,1-2H3/b6-5+,9-7-,10-8+ |
| InChIKey | VZFVFYWCHFJFBU-YHDXSUECSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|