C9H17NO5 — CID 10900110
ethyl 2-[(2R,3S,4R,5R)-3,4,5-trihydroxypiperidin-2-yl]acetate (PubChem CID 10900110) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is ethyl 2-[(2R,3S,4R,5R)-3,4,5-trihydroxypiperidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S,4R,5R)-3,4,5-trihydroxypiperidin-2-yl]acetate |
|---|---|
| PubChem CID | 10900110 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | ethyl 2-[(2R,3S,4R,5R)-3,4,5-trihydroxypiperidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1NC[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H17NO5/c1-2-15-7(12)3-5-8(13)9(14)6(11)4-10-5/h5-6,8-11,13-14H,2-4H2,1H3/t5-,6-,8+,9-/m1/s1 |
| InChIKey | CMUJNFZPIWFRMJ-MTSNSDSCSA-N |
| XLogP | -2.01 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |