C7H13NO2S — CID 70429766
ethyl 2-[(2S)-1,3-thiazolidin-2-yl]acetate (PubChem CID 70429766) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is ethyl 2-[(2S)-1,3-thiazolidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S)-1,3-thiazolidin-2-yl]acetate |
|---|---|
| PubChem CID | 70429766 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | ethyl 2-[(2S)-1,3-thiazolidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1NCCS1 |
| InChI | InChI=1S/C7H13NO2S/c1-2-10-7(9)5-6-8-3-4-11-6/h6,8H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | ZANISHQWRNLICS-LURJTMIESA-N |
| XLogP | 0.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |