C14H19F3N2O — CID 109005843
2-(3-methylbutylamino)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 109005843) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-methylbutylamino)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 109005843 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-(3-methylbutylamino)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)CCNCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O/c1-10(2)7-8-18-9-13(20)19-12-6-4-3-5-11(12)14(15,16)17/h3-6,10,18H,7-9H2,1-2H3,(H,19,20) |
| InChIKey | QBJHKJPOHNQRQT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|