C23H22N2O4 — CID 109010741
ethyl 2-[[2-oxo-2-(4-phenoxyanilino)ethyl]amino]benzoate (PubChem CID 109010741) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl 2-[[2-oxo-2-(4-phenoxyanilino)ethyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-oxo-2-(4-phenoxyanilino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 109010741 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | ethyl 2-[[2-oxo-2-(4-phenoxyanilino)ethyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NCC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-2-28-23(27)20-10-6-7-11-21(20)24-16-22(26)25-17-12-14-19(15-13-17)29-18-8-4-3-5-9-18/h3-15,24H,2,16H2,1H3,(H,25,26) |
| InChIKey | OUNUFDXNYCBTKP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |