C13H18O5 — CID 10901181
methyl 1-[(E)-4-methoxy-4-oxobut-2-enyl]-2-oxocyclohexane-1-carboxylate (PubChem CID 10901181) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl 1-[(E)-4-methoxy-4-oxobut-2-enyl]-2-oxocyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(E)-4-methoxy-4-oxobut-2-enyl]-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10901181 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | methyl 1-[(E)-4-methoxy-4-oxobut-2-enyl]-2-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)/C=C/CC1(C(=O)OC)CCCCC1=O |
| InChI | InChI=1S/C13H18O5/c1-17-11(15)7-5-9-13(12(16)18-2)8-4-3-6-10(13)14/h5,7H,3-4,6,8-9H2,1-2H3/b7-5+ |
| InChIKey | YSERVYXHOBXGAM-FNORWQNLSA-N |
| XLogP | 1.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|