C10H21NOS3 — CID 10901592
(2R)-1,1,1-tris(methylsulfanyl)-2-[(2S)-pyrrolidin-2-yl]propan-2-ol (PubChem CID 10901592) has the molecular formula C10H21NOS3 and a molecular weight of 267.48 g/mol. Its IUPAC name is (2R)-1,1,1-tris(methylsulfanyl)-2-[(2S)-pyrrolidin-2-yl]propan-2-ol.
| Compound Name | (2R)-1,1,1-tris(methylsulfanyl)-2-[(2S)-pyrrolidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 10901592 |
| Molecular Formula | C10H21NOS3 |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2R)-1,1,1-tris(methylsulfanyl)-2-[(2S)-pyrrolidin-2-yl]propan-2-ol |
| SMILES | CSC(SC)(SC)[C@](C)(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H21NOS3/c1-9(12,8-6-5-7-11-8)10(13-2,14-3)15-4/h8,11-12H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | FAGNUSLTTATSJC-DTWKUNHWSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|