C10H19NOS2 — CID 10988172
(1R)-1-(1,3-dithian-2-yl)-1-[(2S)-pyrrolidin-2-yl]ethanol (PubChem CID 10988172) has the molecular formula C10H19NOS2 and a molecular weight of 233.40 g/mol. Its IUPAC name is (1R)-1-(1,3-dithian-2-yl)-1-[(2S)-pyrrolidin-2-yl]ethanol.
| Compound Name | (1R)-1-(1,3-dithian-2-yl)-1-[(2S)-pyrrolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 10988172 |
| Molecular Formula | C10H19NOS2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (1R)-1-(1,3-dithian-2-yl)-1-[(2S)-pyrrolidin-2-yl]ethanol |
| SMILES | C[C@](O)(C1SCCCS1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H19NOS2/c1-10(12,8-4-2-5-11-8)9-13-6-3-7-14-9/h8-9,11-12H,2-7H2,1H3/t8-,10+/m0/s1 |
| InChIKey | PIGCMKSRSWAAFH-WCBMZHEXSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |