C10H9F5N2O2 — CID 10902121
1,3,6-trimethyl-5-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]pyrimidine-2,4-dione (PubChem CID 10902121) has the molecular formula C10H9F5N2O2 and a molecular weight of 284.18 g/mol. Its IUPAC name is 1,3,6-trimethyl-5-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]pyrimidine-2,4-dione.
| Compound Name | 1,3,6-trimethyl-5-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10902121 |
| Molecular Formula | C10H9F5N2O2 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1,3,6-trimethyl-5-[(Z)-1,2,3,3,3-pentafluoroprop-1-enyl]pyrimidine-2,4-dione |
| SMILES | Cc1c(/C(F)=C(/F)C(F)(F)F)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C10H9F5N2O2/c1-4-5(6(11)7(12)10(13,14)15)8(18)17(3)9(19)16(4)2/h1-3H3/b7-6- |
| InChIKey | WESQKGFHDWKDSP-SREVYHEPSA-N |
| XLogP | 1.56 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |