C18H29N3O3S — CID 109026566
N-[4-(diethylamino)-2-methylphenyl]-3-[(1,1-dioxothiolan-3-yl)amino]propanamide (PubChem CID 109026566) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-3-[(1,1-dioxothiolan-3-yl)amino]propanamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-3-[(1,1-dioxothiolan-3-yl)amino]propanamide |
|---|---|
| PubChem CID | 109026566 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-3-[(1,1-dioxothiolan-3-yl)amino]propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCNC2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C18H29N3O3S/c1-4-21(5-2)16-6-7-17(14(3)12-16)20-18(22)8-10-19-15-9-11-25(23,24)13-15/h6-7,12,15,19H,4-5,8-11,13H2,1-3H3,(H,20,22) |
| InChIKey | NCSKBATUHUWFBF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|