C20H33N3O3S — CID 109028692
3-[4-(diethylamino)-2-methylanilino]-N-(1,1-dioxothiolan-3-yl)-N-ethylpropanamide (PubChem CID 109028692) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is 3-[4-(diethylamino)-2-methylanilino]-N-(1,1-dioxothiolan-3-yl)-N-ethylpropanamide.
| Compound Name | 3-[4-(diethylamino)-2-methylanilino]-N-(1,1-dioxothiolan-3-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 109028692 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 3-[4-(diethylamino)-2-methylanilino]-N-(1,1-dioxothiolan-3-yl)-N-ethylpropanamide |
| SMILES | CCN(CC)c1ccc(NCCC(=O)N(CC)C2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C20H33N3O3S/c1-5-22(6-2)17-8-9-19(16(4)14-17)21-12-10-20(24)23(7-3)18-11-13-27(25,26)15-18/h8-9,14,18,21H,5-7,10-13,15H2,1-4H3 |
| InChIKey | XASVTMUCZDLFFH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|