C12H18FN2+ — CID 10903809
4-(4-fluorophenyl)-1,1-dimethylpiperazin-1-ium (PubChem CID 10903809) has the molecular formula C12H18FN2+ and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,1-dimethylpiperazin-1-ium.
| Compound Name | 4-(4-fluorophenyl)-1,1-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 10903809 |
| Molecular Formula | C12H18FN2+ |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 4-(4-fluorophenyl)-1,1-dimethylpiperazin-1-ium |
| SMILES | C[N+]1(C)CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C12H18FN2/c1-15(2)9-7-14(8-10-15)12-5-3-11(13)4-6-12/h3-6H,7-10H2,1-2H3/q+1 |
| InChIKey | XWNDBFKGLWHCOA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|