C12H15FN2 — CID 90325892
2-(4-fluorophenyl)-6-methyl-2,6-diazaspiro[3.3]heptane (PubChem CID 90325892) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-methyl-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-(4-fluorophenyl)-6-methyl-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 90325892 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(4-fluorophenyl)-6-methyl-2,6-diazaspiro[3.3]heptane |
| SMILES | CN1CC2(C1)CN(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C12H15FN2/c1-14-6-12(7-14)8-15(9-12)11-4-2-10(13)3-5-11/h2-5H,6-9H2,1H3 |
| InChIKey | PXCIYIOSGJYGPZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |