C17H16F3NO3 — CID 10903899
benzyl (2R)-3,3,3-trifluoro-2-(4-methoxyanilino)propanoate (PubChem CID 10903899) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is benzyl (2R)-3,3,3-trifluoro-2-(4-methoxyanilino)propanoate.
| Compound Name | benzyl (2R)-3,3,3-trifluoro-2-(4-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 10903899 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | benzyl (2R)-3,3,3-trifluoro-2-(4-methoxyanilino)propanoate |
| SMILES | COc1ccc(N[C@H](C(=O)OCc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO3/c1-23-14-9-7-13(8-10-14)21-15(17(18,19)20)16(22)24-11-12-5-3-2-4-6-12/h2-10,15,21H,11H2,1H3/t15-/m1/s1 |
| InChIKey | IJGQOIFGLOCHLN-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|