C23H20N2O — CID 10903934
(15R,16S)-16-methyl-N-pyridin-2-yltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 10903934) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is (15R,16S)-16-methyl-N-pyridin-2-yltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | (15R,16S)-16-methyl-N-pyridin-2-yltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 10903934 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (15R,16S)-16-methyl-N-pyridin-2-yltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | C[C@H]1C2c3ccccc3C(c3ccccc32)[C@@H]1C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C23H20N2O/c1-14-20-15-8-2-4-10-17(15)22(18-11-5-3-9-16(18)20)21(14)23(26)25-19-12-6-7-13-24-19/h2-14,20-22H,1H3,(H,24,25,26)/t14-,20?,21+,22?/m0/s1 |
| InChIKey | IIQBXRMRMZEDNV-WQYAFRAASA-N |
| XLogP | 4.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |