C11H17Cl2N3O2 — CID 120937700
(2R,3S)-2-methyl-N-pyridin-2-ylmorpholine-3-carboxamide;dihydrochloride (PubChem CID 120937700) has the molecular formula C11H17Cl2N3O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-pyridin-2-ylmorpholine-3-carboxamide;dihydrochloride.
| Compound Name | (2R,3S)-2-methyl-N-pyridin-2-ylmorpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120937700 |
| Molecular Formula | C11H17Cl2N3O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (2R,3S)-2-methyl-N-pyridin-2-ylmorpholine-3-carboxamide;dihydrochloride |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1ccccn1.Cl.Cl |
| InChI | InChI=1S/C11H15N3O2.2ClH/c1-8-10(13-6-7-16-8)11(15)14-9-4-2-3-5-12-9;;/h2-5,8,10,13H,6-7H2,1H3,(H,12,14,15);2*1H/t8-,10+;;/m1../s1 |
| InChIKey | QGZJUFBOJSWNNA-WAZPLGGWSA-N |
| XLogP | 1.24 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |