C15H19Cl2N3O2 — CID 120937933
(2R,3S)-2-methyl-N-quinolin-2-ylmorpholine-3-carboxamide;dihydrochloride (PubChem CID 120937933) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-quinolin-2-ylmorpholine-3-carboxamide;dihydrochloride.
| Compound Name | (2R,3S)-2-methyl-N-quinolin-2-ylmorpholine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120937933 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (2R,3S)-2-methyl-N-quinolin-2-ylmorpholine-3-carboxamide;dihydrochloride |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1ccc2ccccc2n1.Cl.Cl |
| InChI | InChI=1S/C15H17N3O2.2ClH/c1-10-14(16-8-9-20-10)15(19)18-13-7-6-11-4-2-3-5-12(11)17-13;;/h2-7,10,14,16H,8-9H2,1H3,(H,17,18,19);2*1H/t10-,14+;;/m1../s1 |
| InChIKey | WWWAOUBZKMXERS-ROXZIJFUSA-N |
| XLogP | 2.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |