C11H15N3O2 — CID 120937694
(2R,3S)-2-methyl-N-pyridin-3-ylmorpholine-3-carboxamide (PubChem CID 120937694) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-pyridin-3-ylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-pyridin-3-ylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 120937694 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (2R,3S)-2-methyl-N-pyridin-3-ylmorpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C11H15N3O2/c1-8-10(13-5-6-16-8)11(15)14-9-3-2-4-12-7-9/h2-4,7-8,10,13H,5-6H2,1H3,(H,14,15)/t8-,10+/m1/s1 |
| InChIKey | GOVYOLALXUQRFQ-SCZZXKLOSA-N |
| XLogP | 0.40 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |